About (5Z)-5-(2,3-dihydroxybutylidene)-3-[(E)-prop-1-enyl]furan-2-one
(5Z)-5-(2,3-dihydroxybutylidene)-3-[(E)-prop-1-enyl]furan-2-one (PubChem CID 122206279) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is (5Z)-5-(2,3-dihydroxybutylidene)-3-[(E)-prop-1-enyl]furan-2-one.
Molecular Properties
| Compound Name | (5Z)-5-(2,3-dihydroxybutylidene)-3-[(E)-prop-1-enyl]furan-2-one |
| PubChem CID | 122206279 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (5Z)-5-(2,3-dihydroxybutylidene)-3-[(E)-prop-1-enyl]furan-2-one |
| SMILES | C/C=C/C1=C/C(=C/C(O)C(C)O)OC1=O |
| InChI | InChI=1S/C11H14O4/c1-3-4-8-5-9(15-11(8)14)6-10(13)7(2)12/h3-7,10,12-13H,1-2H3/b4-3+,9-6- |
| InChIKey | GHAQSPHOVQZZBH-KXIWCOCFSA-N |
| XLogP | 0.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5Z)-5-(2,3-dihydroxybutylidene)-3-[(E)-prop-1-enyl]furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-(2,3-dihydroxybutylidene)-3-[(E)-prop-1-enyl]furan-2-one?
The IUPAC name of (5Z)-5-(2,3-dihydroxybutylidene)-3-[(E)-prop-1-enyl]furan-2-one (CID 122206279) is (5Z)-5-(2,3-dihydroxybutylidene)-3-[(E)-prop-1-enyl]furan-2-one.
What is the SMILES notation for (5Z)-5-(2,3-dihydroxybutylidene)-3-[(E)-prop-1-enyl]furan-2-one?
The canonical SMILES for (5Z)-5-(2,3-dihydroxybutylidene)-3-[(E)-prop-1-enyl]furan-2-one is C/C=C/C1=C/C(=C/C(O)C(C)O)OC1=O.
What is the InChIKey of (5Z)-5-(2,3-dihydroxybutylidene)-3-[(E)-prop-1-enyl]furan-2-one?
The InChIKey is GHAQSPHOVQZZBH-KXIWCOCFSA-N. The full InChI is InChI=1S/C11H14O4/c1-3-4-8-5-9(15-11(8)14)6-10(13)7(2)12/h3-7,10,12-13H,1-2H3/b4-3+,9-6-.
What are the key properties of (5Z)-5-(2,3-dihydroxybutylidene)-3-[(E)-prop-1-enyl]furan-2-one?
(5Z)-5-(2,3-dihydroxybutylidene)-3-[(E)-prop-1-enyl]furan-2-one has a molecular weight of 210.23 g/mol, XLogP of 0.67, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-(2,3-dihydroxybutylidene)-3-[(E)-prop-1-enyl]furan-2-one is sourced from PubChem (CID 122206279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).