C18H20O4 — CID 122206298
(1R,3R,4S)-1-(4-hydroxyphenyl)-3,4,5-trimethyl-3,4-dihydro-1H-isochromene-6,8-diol (PubChem CID 122206298) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is (1R,3R,4S)-1-(4-hydroxyphenyl)-3,4,5-trimethyl-3,4-dihydro-1H-isochromene-6,8-diol.
| Compound Name | (1R,3R,4S)-1-(4-hydroxyphenyl)-3,4,5-trimethyl-3,4-dihydro-1H-isochromene-6,8-diol |
|---|---|
| PubChem CID | 122206298 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (1R,3R,4S)-1-(4-hydroxyphenyl)-3,4,5-trimethyl-3,4-dihydro-1H-isochromene-6,8-diol |
| SMILES | Cc1c(O)cc(O)c2c1[C@H](C)[C@@H](C)O[C@@H]2c1ccc(O)cc1 |
| InChI | InChI=1S/C18H20O4/c1-9-11(3)22-18(12-4-6-13(19)7-5-12)17-15(21)8-14(20)10(2)16(9)17/h4-9,11,18-21H,1-3H3/t9-,11-,18-/m1/s1 |
| InChIKey | VJFJLZJZRYKHIS-RJFHMIALSA-N |
| XLogP | 3.72 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |