C18H14F3N3S — CID 122206372
N-(4-methylphenyl)-4-phenylsulfanyl-5-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 122206372) has the molecular formula C18H14F3N3S and a molecular weight of 361.39 g/mol. Its IUPAC name is N-(4-methylphenyl)-4-phenylsulfanyl-5-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-(4-methylphenyl)-4-phenylsulfanyl-5-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 122206372 |
| Molecular Formula | C18H14F3N3S |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | N-(4-methylphenyl)-4-phenylsulfanyl-5-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Cc1ccc(Nc2ncc(C(F)(F)F)c(Sc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C18H14F3N3S/c1-12-7-9-13(10-8-12)23-17-22-11-15(18(19,20)21)16(24-17)25-14-5-3-2-4-6-14/h2-11H,1H3,(H,22,23,24) |
| InChIKey | ZNBBFGLGBBKEOD-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |