About 1-chloro-3-phenylazulene
1-chloro-3-phenylazulene (PubChem CID 122206696) has the molecular formula C16H11Cl
and a molecular weight of 238.72 g/mol. Its IUPAC name is 1-chloro-3-phenylazulene.
Molecular Properties
| Compound Name | 1-chloro-3-phenylazulene |
| PubChem CID | 122206696 |
| Molecular Formula | C16H11Cl |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 1-chloro-3-phenylazulene |
| SMILES | Clc1cc(-c2ccccc2)c2cccccc1-2 |
| InChI | InChI=1S/C16H11Cl/c17-16-11-15(12-7-3-1-4-8-12)13-9-5-2-6-10-14(13)16/h1-11H |
| InChIKey | KLMRGONNCSOYLN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-3-phenylazulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-phenylazulene?
The IUPAC name of 1-chloro-3-phenylazulene (CID 122206696) is 1-chloro-3-phenylazulene.
What is the SMILES notation for 1-chloro-3-phenylazulene?
The canonical SMILES for 1-chloro-3-phenylazulene is Clc1cc(-c2ccccc2)c2cccccc1-2.
What is the InChIKey of 1-chloro-3-phenylazulene?
The InChIKey is KLMRGONNCSOYLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl/c17-16-11-15(12-7-3-1-4-8-12)13-9-5-2-6-10-14(13)16/h1-11H.
What are the key properties of 1-chloro-3-phenylazulene?
1-chloro-3-phenylazulene has a molecular weight of 238.72 g/mol, XLogP of 5.11, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-phenylazulene is sourced from PubChem (CID 122206696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).