About ethyl (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxyacetate
ethyl (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxyacetate (PubChem CID 122206731) has the molecular formula C10H16O6
and a molecular weight of 232.23 g/mol. Its IUPAC name is ethyl (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxyacetate.
Molecular Properties
| Compound Name | ethyl (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxyacetate |
| PubChem CID | 122206731 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | ethyl (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxyacetate |
| SMILES | CCOC(=O)[C@H](O)[C@@H]1OC(C)(C)OCC1=O |
| InChI | InChI=1S/C10H16O6/c1-4-14-9(13)7(12)8-6(11)5-15-10(2,3)16-8/h7-8,12H,4-5H2,1-3H3/t7-,8-/m1/s1 |
| InChIKey | ZOYYOWLJONABFC-HTQZYQBOSA-N |
| XLogP | -0.37 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxyacetate?
The IUPAC name of ethyl (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxyacetate (CID 122206731) is ethyl (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxyacetate.
What is the SMILES notation for ethyl (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxyacetate?
The canonical SMILES for ethyl (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxyacetate is CCOC(=O)[C@H](O)[C@@H]1OC(C)(C)OCC1=O.
What is the InChIKey of ethyl (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxyacetate?
The InChIKey is ZOYYOWLJONABFC-HTQZYQBOSA-N. The full InChI is InChI=1S/C10H16O6/c1-4-14-9(13)7(12)8-6(11)5-15-10(2,3)16-8/h7-8,12H,4-5H2,1-3H3/t7-,8-/m1/s1.
What are the key properties of ethyl (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxyacetate?
ethyl (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxyacetate has a molecular weight of 232.23 g/mol, XLogP of -0.37, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxan-4-yl]-2-hydroxyacetate is sourced from PubChem (CID 122206731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).