About ethyl (2R)-2-hydroxy-2-[(1S,5S)-5-methyl-2-oxocyclohexyl]acetate
ethyl (2R)-2-hydroxy-2-[(1S,5S)-5-methyl-2-oxocyclohexyl]acetate (PubChem CID 122206733) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is ethyl (2R)-2-hydroxy-2-[(1S,5S)-5-methyl-2-oxocyclohexyl]acetate.
Molecular Properties
| Compound Name | ethyl (2R)-2-hydroxy-2-[(1S,5S)-5-methyl-2-oxocyclohexyl]acetate |
| PubChem CID | 122206733 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | ethyl (2R)-2-hydroxy-2-[(1S,5S)-5-methyl-2-oxocyclohexyl]acetate |
| SMILES | CCOC(=O)[C@H](O)[C@@H]1C[C@@H](C)CCC1=O |
| InChI | InChI=1S/C11H18O4/c1-3-15-11(14)10(13)8-6-7(2)4-5-9(8)12/h7-8,10,13H,3-6H2,1-2H3/t7-,8+,10+/m0/s1 |
| InChIKey | WEDWJALUFZDOFM-QXFUBDJGSA-N |
| XLogP | 0.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (2R)-2-hydroxy-2-[(1S,5S)-5-methyl-2-oxocyclohexyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-hydroxy-2-[(1S,5S)-5-methyl-2-oxocyclohexyl]acetate?
The IUPAC name of ethyl (2R)-2-hydroxy-2-[(1S,5S)-5-methyl-2-oxocyclohexyl]acetate (CID 122206733) is ethyl (2R)-2-hydroxy-2-[(1S,5S)-5-methyl-2-oxocyclohexyl]acetate.
What is the SMILES notation for ethyl (2R)-2-hydroxy-2-[(1S,5S)-5-methyl-2-oxocyclohexyl]acetate?
The canonical SMILES for ethyl (2R)-2-hydroxy-2-[(1S,5S)-5-methyl-2-oxocyclohexyl]acetate is CCOC(=O)[C@H](O)[C@@H]1C[C@@H](C)CCC1=O.
What is the InChIKey of ethyl (2R)-2-hydroxy-2-[(1S,5S)-5-methyl-2-oxocyclohexyl]acetate?
The InChIKey is WEDWJALUFZDOFM-QXFUBDJGSA-N. The full InChI is InChI=1S/C11H18O4/c1-3-15-11(14)10(13)8-6-7(2)4-5-9(8)12/h7-8,10,13H,3-6H2,1-2H3/t7-,8+,10+/m0/s1.
What are the key properties of ethyl (2R)-2-hydroxy-2-[(1S,5S)-5-methyl-2-oxocyclohexyl]acetate?
ethyl (2R)-2-hydroxy-2-[(1S,5S)-5-methyl-2-oxocyclohexyl]acetate has a molecular weight of 214.26 g/mol, XLogP of 0.92, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-hydroxy-2-[(1S,5S)-5-methyl-2-oxocyclohexyl]acetate is sourced from PubChem (CID 122206733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).