About methyl 5-(2,4-dichlorophenyl)-3-nitro-1,2-oxazole-4-carboxylate
methyl 5-(2,4-dichlorophenyl)-3-nitro-1,2-oxazole-4-carboxylate (PubChem CID 122207398) has the molecular formula C11H6Cl2N2O5
and a molecular weight of 317.08 g/mol. Its IUPAC name is methyl 5-(2,4-dichlorophenyl)-3-nitro-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(2,4-dichlorophenyl)-3-nitro-1,2-oxazole-4-carboxylate |
| PubChem CID | 122207398 |
| Molecular Formula | C11H6Cl2N2O5 |
| Molecular Weight | 317.08 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | methyl 5-(2,4-dichlorophenyl)-3-nitro-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)c1c([N+](=O)[O-])noc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H6Cl2N2O5/c1-19-11(16)8-9(20-14-10(8)15(17)18)6-3-2-5(12)4-7(6)13/h2-4H,1H3 |
| InChIKey | MLNODLHXHWUMCE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.08 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-(2,4-dichlorophenyl)-3-nitro-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(2,4-dichlorophenyl)-3-nitro-1,2-oxazole-4-carboxylate?
The IUPAC name of methyl 5-(2,4-dichlorophenyl)-3-nitro-1,2-oxazole-4-carboxylate (CID 122207398) is methyl 5-(2,4-dichlorophenyl)-3-nitro-1,2-oxazole-4-carboxylate.
What is the SMILES notation for methyl 5-(2,4-dichlorophenyl)-3-nitro-1,2-oxazole-4-carboxylate?
The canonical SMILES for methyl 5-(2,4-dichlorophenyl)-3-nitro-1,2-oxazole-4-carboxylate is COC(=O)c1c([N+](=O)[O-])noc1-c1ccc(Cl)cc1Cl.
What is the InChIKey of methyl 5-(2,4-dichlorophenyl)-3-nitro-1,2-oxazole-4-carboxylate?
The InChIKey is MLNODLHXHWUMCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6Cl2N2O5/c1-19-11(16)8-9(20-14-10(8)15(17)18)6-3-2-5(12)4-7(6)13/h2-4H,1H3.
What are the key properties of methyl 5-(2,4-dichlorophenyl)-3-nitro-1,2-oxazole-4-carboxylate?
methyl 5-(2,4-dichlorophenyl)-3-nitro-1,2-oxazole-4-carboxylate has a molecular weight of 317.08 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(2,4-dichlorophenyl)-3-nitro-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 122207398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).