C16H16F2N2S2 — CID 122207509
5,6-difluoro-4-(5-hexylthiophen-2-yl)-2,1,3-benzothiadiazole (PubChem CID 122207509) has the molecular formula C16H16F2N2S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 5,6-difluoro-4-(5-hexylthiophen-2-yl)-2,1,3-benzothiadiazole.
| Compound Name | 5,6-difluoro-4-(5-hexylthiophen-2-yl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 122207509 |
| Molecular Formula | C16H16F2N2S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 5,6-difluoro-4-(5-hexylthiophen-2-yl)-2,1,3-benzothiadiazole |
| SMILES | CCCCCCc1ccc(-c2c(F)c(F)cc3nsnc23)s1 |
| InChI | InChI=1S/C16H16F2N2S2/c1-2-3-4-5-6-10-7-8-13(21-10)14-15(18)11(17)9-12-16(14)20-22-19-12/h7-9H,2-6H2,1H3 |
| InChIKey | FLEMSIVXLPWGSW-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|