C18H18BF2N3 — CID 122207824
2,2-difluoro-4,6,10,12-tetramethyl-8-pyridin-4-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 122207824) has the molecular formula C18H18BF2N3 and a molecular weight of 325.17 g/mol. Its IUPAC name is 2,2-difluoro-4,6,10,12-tetramethyl-8-pyridin-4-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-4,6,10,12-tetramethyl-8-pyridin-4-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 122207824 |
| Molecular Formula | C18H18BF2N3 |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 2,2-difluoro-4,6,10,12-tetramethyl-8-pyridin-4-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=CC(C)=[N+]2C1=C(c1ccncc1)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C18H18BF2N3/c1-11-9-13(3)23-17(11)16(15-5-7-22-8-6-15)18-12(2)10-14(4)24(18)19(23,20)21/h5-10H,1-4H3 |
| InChIKey | XFIRNBPRJOCUNR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 20.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|