About 3-pyren-1-yl-2H-azirine
3-pyren-1-yl-2H-azirine (PubChem CID 122207976) has the molecular formula C18H11N
and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-pyren-1-yl-2H-azirine.
Molecular Properties
| Compound Name | 3-pyren-1-yl-2H-azirine |
| PubChem CID | 122207976 |
| Molecular Formula | C18H11N |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 3-pyren-1-yl-2H-azirine |
| SMILES | c1cc2ccc3ccc(C4=NC4)c4ccc(c1)c2c34 |
| InChI | InChI=1S/C18H11N/c1-2-11-4-5-13-6-8-14(16-10-19-16)15-9-7-12(3-1)17(11)18(13)15/h1-9H,10H2 |
| InChIKey | BAXQMXVQLFPXRS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-pyren-1-yl-2H-azirine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyren-1-yl-2H-azirine?
The IUPAC name of 3-pyren-1-yl-2H-azirine (CID 122207976) is 3-pyren-1-yl-2H-azirine.
What is the SMILES notation for 3-pyren-1-yl-2H-azirine?
The canonical SMILES for 3-pyren-1-yl-2H-azirine is c1cc2ccc3ccc(C4=NC4)c4ccc(c1)c2c34.
What is the InChIKey of 3-pyren-1-yl-2H-azirine?
The InChIKey is BAXQMXVQLFPXRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11N/c1-2-11-4-5-13-6-8-14(16-10-19-16)15-9-7-12(3-1)17(11)18(13)15/h1-9H,10H2.
What are the key properties of 3-pyren-1-yl-2H-azirine?
3-pyren-1-yl-2H-azirine has a molecular weight of 241.29 g/mol, XLogP of 4.39, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyren-1-yl-2H-azirine is sourced from PubChem (CID 122207976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).