C29H24BF10N — CID 122208209
(2-diethylazaniumylidene-2-phenylethyl)-[(1E)-3-methylbuta-1,3-dienyl]-bis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 122208209) has the molecular formula C29H24BF10N and a molecular weight of 587.31 g/mol. Its IUPAC name is (2-diethylazaniumylidene-2-phenylethyl)-[(1E)-3-methylbuta-1,3-dienyl]-bis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | (2-diethylazaniumylidene-2-phenylethyl)-[(1E)-3-methylbuta-1,3-dienyl]-bis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 122208209 |
| Molecular Formula | C29H24BF10N |
| Molecular Weight | 587.31 g/mol |
| Exact Mass | 587.18 |
| IUPAC Name | (2-diethylazaniumylidene-2-phenylethyl)-[(1E)-3-methylbuta-1,3-dienyl]-bis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | C=C(C)/C=C/[B-](CC(c1ccccc1)=[N+](CC)CC)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C29H24BF10N/c1-5-41(6-2)17(16-10-8-7-9-11-16)14-30(13-12-15(3)4,18-20(31)24(35)28(39)25(36)21(18)32)19-22(33)26(37)29(40)27(38)23(19)34/h7-13H,3,5-6,14H2,1-2,4H3/b13-12+ |
| InChIKey | NJHLUPHWIOTIAF-OUKQBFOZSA-N |
| XLogP | 6.85 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.31 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|