C19H29N2+ — CID 122208346
(1R,5S)-1,2,8,8-tetramethyl-4-(2,4,6-trimethylphenyl)-4-aza-2-azoniabicyclo[3.2.1]oct-2-ene (PubChem CID 122208346) has the molecular formula C19H29N2+ and a molecular weight of 285.46 g/mol. Its IUPAC name is (1R,5S)-1,2,8,8-tetramethyl-4-(2,4,6-trimethylphenyl)-4-aza-2-azoniabicyclo[3.2.1]oct-2-ene.
| Compound Name | (1R,5S)-1,2,8,8-tetramethyl-4-(2,4,6-trimethylphenyl)-4-aza-2-azoniabicyclo[3.2.1]oct-2-ene |
|---|---|
| PubChem CID | 122208346 |
| Molecular Formula | C19H29N2+ |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | (1R,5S)-1,2,8,8-tetramethyl-4-(2,4,6-trimethylphenyl)-4-aza-2-azoniabicyclo[3.2.1]oct-2-ene |
| SMILES | Cc1cc(C)c(N2C=[N+](C)[C@]3(C)CC[C@H]2C3(C)C)c(C)c1 |
| InChI | InChI=1S/C19H29N2/c1-13-10-14(2)17(15(3)11-13)21-12-20(7)19(6)9-8-16(21)18(19,4)5/h10-12,16H,8-9H2,1-7H3/q+1/t16-,19+/m0/s1 |
| InChIKey | WYBMCXMSEPVXKR-QFBILLFUSA-N |
| XLogP | 4.05 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|