C16H19ClO8 — CID 122208488
(1R,2S,3S,4aS,9aR,10S)-9a-chloro-1,2,3,4a,8,10-hexahydroxy-6-methoxy-3-methyl-1,2,4,10-tetrahydroanthracen-9-one (PubChem CID 122208488) has the molecular formula C16H19ClO8 and a molecular weight of 374.77 g/mol. Its IUPAC name is (1R,2S,3S,4aS,9aR,10S)-9a-chloro-1,2,3,4a,8,10-hexahydroxy-6-methoxy-3-methyl-1,2,4,10-tetrahydroanthracen-9-one.
| Compound Name | (1R,2S,3S,4aS,9aR,10S)-9a-chloro-1,2,3,4a,8,10-hexahydroxy-6-methoxy-3-methyl-1,2,4,10-tetrahydroanthracen-9-one |
|---|---|
| PubChem CID | 122208488 |
| Molecular Formula | C16H19ClO8 |
| Molecular Weight | 374.77 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | (1R,2S,3S,4aS,9aR,10S)-9a-chloro-1,2,3,4a,8,10-hexahydroxy-6-methoxy-3-methyl-1,2,4,10-tetrahydroanthracen-9-one |
| SMILES | COc1cc(O)c2c(c1)[C@H](O)[C@@]1(O)C[C@](C)(O)[C@@H](O)[C@@H](O)[C@]1(Cl)C2=O |
| InChI | InChI=1S/C16H19ClO8/c1-14(23)5-15(24)10(19)7-3-6(25-2)4-8(18)9(7)11(20)16(15,17)13(22)12(14)21/h3-4,10,12-13,18-19,21-24H,5H2,1-2H3/t10-,12-,13+,14-,15-,16+/m0/s1 |
| InChIKey | NJTWURSBGZMXTO-OVSZIMMFSA-N |
| XLogP | -0.78 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.77 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|