About cis-2-ethoxyethyl (1R,2R)-1-cyano-2-(difluoromethyl)cyclopropane-1-carboxylate
cis-2-ethoxyethyl (1R,2R)-1-cyano-2-(difluoromethyl)cyclopropane-1-carboxylate (PubChem CID 122208588) has the molecular formula C10H13F2NO3
and a molecular weight of 233.21 g/mol. Its IUPAC name is cis-2-ethoxyethyl (1R,2R)-1-cyano-2-(difluoromethyl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | cis-2-ethoxyethyl (1R,2R)-1-cyano-2-(difluoromethyl)cyclopropane-1-carboxylate |
| PubChem CID | 122208588 |
| Molecular Formula | C10H13F2NO3 |
| Molecular Weight | 233.21 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | cis-2-ethoxyethyl (1R,2R)-1-cyano-2-(difluoromethyl)cyclopropane-1-carboxylate |
| SMILES | CCOCCOC(=O)[C@]1(C#N)C[C@H]1C(F)F |
| InChI | InChI=1S/C10H13F2NO3/c1-2-15-3-4-16-9(14)10(6-13)5-7(10)8(11)12/h7-8H,2-5H2,1H3/t7-,10-/m0/s1 |
| InChIKey | NINSZURJVZCZEQ-XVKPBYJWSA-N |
| XLogP | 1.36 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cis-2-ethoxyethyl (1R,2R)-1-cyano-2-(difluoromethyl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-2-ethoxyethyl (1R,2R)-1-cyano-2-(difluoromethyl)cyclopropane-1-carboxylate?
The IUPAC name of cis-2-ethoxyethyl (1R,2R)-1-cyano-2-(difluoromethyl)cyclopropane-1-carboxylate (CID 122208588) is cis-2-ethoxyethyl (1R,2R)-1-cyano-2-(difluoromethyl)cyclopropane-1-carboxylate.
What is the SMILES notation for cis-2-ethoxyethyl (1R,2R)-1-cyano-2-(difluoromethyl)cyclopropane-1-carboxylate?
The canonical SMILES for cis-2-ethoxyethyl (1R,2R)-1-cyano-2-(difluoromethyl)cyclopropane-1-carboxylate is CCOCCOC(=O)[C@]1(C#N)C[C@H]1C(F)F.
What is the InChIKey of cis-2-ethoxyethyl (1R,2R)-1-cyano-2-(difluoromethyl)cyclopropane-1-carboxylate?
The InChIKey is NINSZURJVZCZEQ-XVKPBYJWSA-N. The full InChI is InChI=1S/C10H13F2NO3/c1-2-15-3-4-16-9(14)10(6-13)5-7(10)8(11)12/h7-8H,2-5H2,1H3/t7-,10-/m0/s1.
What are the key properties of cis-2-ethoxyethyl (1R,2R)-1-cyano-2-(difluoromethyl)cyclopropane-1-carboxylate?
cis-2-ethoxyethyl (1R,2R)-1-cyano-2-(difluoromethyl)cyclopropane-1-carboxylate has a molecular weight of 233.21 g/mol, XLogP of 1.36, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-2-ethoxyethyl (1R,2R)-1-cyano-2-(difluoromethyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 122208588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).