C22H17N3O3S — CID 122208667
methyl (2Z)-2-[3-(1,3-benzothiazol-2-yl)-4-methyl-2-oxo-3aH-imidazo[1,2-a]quinolin-1-ylidene]acetate (PubChem CID 122208667) has the molecular formula C22H17N3O3S and a molecular weight of 403.46 g/mol. Its IUPAC name is methyl (2Z)-2-[3-(1,3-benzothiazol-2-yl)-4-methyl-2-oxo-3aH-imidazo[1,2-a]quinolin-1-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[3-(1,3-benzothiazol-2-yl)-4-methyl-2-oxo-3aH-imidazo[1,2-a]quinolin-1-ylidene]acetate |
|---|---|
| PubChem CID | 122208667 |
| Molecular Formula | C22H17N3O3S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | methyl (2Z)-2-[3-(1,3-benzothiazol-2-yl)-4-methyl-2-oxo-3aH-imidazo[1,2-a]quinolin-1-ylidene]acetate |
| SMILES | COC(=O)/C=C1/C(=O)N(c2nc3ccccc3s2)C2C(C)=Cc3ccccc3N12 |
| InChI | InChI=1S/C22H17N3O3S/c1-13-11-14-7-3-5-9-16(14)24-17(12-19(26)28-2)21(27)25(20(13)24)22-23-15-8-4-6-10-18(15)29-22/h3-12,20H,1-2H3/b17-12- |
| InChIKey | OZWWOEBHTULTAA-ATVHPVEESA-N |
| XLogP | 3.95 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|