About 4-[2-(2,4-difluorophenyl)-1-benzothiophen-5-yl]-3,6-dihydro-2H-pyran
4-[2-(2,4-difluorophenyl)-1-benzothiophen-5-yl]-3,6-dihydro-2H-pyran (PubChem CID 122209222) has the molecular formula C19H14F2OS
and a molecular weight of 328.38 g/mol. Its IUPAC name is 4-[2-(2,4-difluorophenyl)-1-benzothiophen-5-yl]-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 4-[2-(2,4-difluorophenyl)-1-benzothiophen-5-yl]-3,6-dihydro-2H-pyran |
| PubChem CID | 122209222 |
| Molecular Formula | C19H14F2OS |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 4-[2-(2,4-difluorophenyl)-1-benzothiophen-5-yl]-3,6-dihydro-2H-pyran |
| SMILES | Fc1ccc(-c2cc3cc(C4=CCOCC4)ccc3s2)c(F)c1 |
| InChI | InChI=1S/C19H14F2OS/c20-15-2-3-16(17(21)11-15)19-10-14-9-13(1-4-18(14)23-19)12-5-7-22-8-6-12/h1-5,9-11H,6-8H2 |
| InChIKey | YNAZONBZMVKSLD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[2-(2,4-difluorophenyl)-1-benzothiophen-5-yl]-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,4-difluorophenyl)-1-benzothiophen-5-yl]-3,6-dihydro-2H-pyran?
The IUPAC name of 4-[2-(2,4-difluorophenyl)-1-benzothiophen-5-yl]-3,6-dihydro-2H-pyran (CID 122209222) is 4-[2-(2,4-difluorophenyl)-1-benzothiophen-5-yl]-3,6-dihydro-2H-pyran.
What is the SMILES notation for 4-[2-(2,4-difluorophenyl)-1-benzothiophen-5-yl]-3,6-dihydro-2H-pyran?
The canonical SMILES for 4-[2-(2,4-difluorophenyl)-1-benzothiophen-5-yl]-3,6-dihydro-2H-pyran is Fc1ccc(-c2cc3cc(C4=CCOCC4)ccc3s2)c(F)c1.
What is the InChIKey of 4-[2-(2,4-difluorophenyl)-1-benzothiophen-5-yl]-3,6-dihydro-2H-pyran?
The InChIKey is YNAZONBZMVKSLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F2OS/c20-15-2-3-16(17(21)11-15)19-10-14-9-13(1-4-18(14)23-19)12-5-7-22-8-6-12/h1-5,9-11H,6-8H2.
What are the key properties of 4-[2-(2,4-difluorophenyl)-1-benzothiophen-5-yl]-3,6-dihydro-2H-pyran?
4-[2-(2,4-difluorophenyl)-1-benzothiophen-5-yl]-3,6-dihydro-2H-pyran has a molecular weight of 328.38 g/mol, XLogP of 5.65, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,4-difluorophenyl)-1-benzothiophen-5-yl]-3,6-dihydro-2H-pyran is sourced from PubChem (CID 122209222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).