C22H23N2+ — CID 122209476
7-[(1-methylindol-3-yl)methylidene]-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene (PubChem CID 122209476) has the molecular formula C22H23N2+ and a molecular weight of 315.44 g/mol. Its IUPAC name is 7-[(1-methylindol-3-yl)methylidene]-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene.
| Compound Name | 7-[(1-methylindol-3-yl)methylidene]-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene |
|---|---|
| PubChem CID | 122209476 |
| Molecular Formula | C22H23N2+ |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 7-[(1-methylindol-3-yl)methylidene]-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene |
| SMILES | Cn1cc(C=c2cc3c4c(c2)CCC[N+]=4CCC3)c2ccccc21 |
| InChI | InChI=1S/C22H23N2/c1-23-15-19(20-8-2-3-9-21(20)23)14-16-12-17-6-4-10-24-11-5-7-18(13-16)22(17)24/h2-3,8-9,12-15H,4-7,10-11H2,1H3/q+1 |
| InChIKey | ZQSDCAKAOCXDHJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|