C16H33N2+ — CID 122209763
di(propan-2-yl)-[(2,2,6,6-tetramethylpiperidin-1-yl)methylidene]azanium (PubChem CID 122209763) has the molecular formula C16H33N2+ and a molecular weight of 253.45 g/mol. Its IUPAC name is di(propan-2-yl)-[(2,2,6,6-tetramethylpiperidin-1-yl)methylidene]azanium.
| Compound Name | di(propan-2-yl)-[(2,2,6,6-tetramethylpiperidin-1-yl)methylidene]azanium |
|---|---|
| PubChem CID | 122209763 |
| Molecular Formula | C16H33N2+ |
| Molecular Weight | 253.45 g/mol |
| Exact Mass | 253.26 |
| IUPAC Name | di(propan-2-yl)-[(2,2,6,6-tetramethylpiperidin-1-yl)methylidene]azanium |
| SMILES | CC(C)[N+](=CN1C(C)(C)CCCC1(C)C)C(C)C |
| InChI | InChI=1S/C16H33N2/c1-13(2)17(14(3)4)12-18-15(5,6)10-9-11-16(18,7)8/h12-14H,9-11H2,1-8H3/q+1 |
| InChIKey | QQDUFRZRVZOXNK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|