About 4-[3-[3-(3,5-dipyridin-4-ylphenyl)-5-fluorophenyl]-5-pyridin-4-ylphenyl]pyridine
4-[3-[3-(3,5-dipyridin-4-ylphenyl)-5-fluorophenyl]-5-pyridin-4-ylphenyl]pyridine (PubChem CID 122209952) has the molecular formula C38H25FN4
and a molecular weight of 556.64 g/mol. Its IUPAC name is 4-[3-[3-(3,5-dipyridin-4-ylphenyl)-5-fluorophenyl]-5-pyridin-4-ylphenyl]pyridine.
Molecular Properties
| Compound Name | 4-[3-[3-(3,5-dipyridin-4-ylphenyl)-5-fluorophenyl]-5-pyridin-4-ylphenyl]pyridine |
| PubChem CID | 122209952 |
| Molecular Formula | C38H25FN4 |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | 4-[3-[3-(3,5-dipyridin-4-ylphenyl)-5-fluorophenyl]-5-pyridin-4-ylphenyl]pyridine |
| SMILES | Fc1cc(-c2cc(-c3ccncc3)cc(-c3ccncc3)c2)cc(-c2cc(-c3ccncc3)cc(-c3ccncc3)c2)c1 |
| InChI | InChI=1S/C38H25FN4/c39-38-24-36(34-19-30(26-1-9-40-10-2-26)17-31(20-34)27-3-11-41-12-4-27)23-37(25-38)35-21-32(28-5-13-42-14-6-28)18-33(22-35)29-7-15-43-16-8-29/h1-25H |
| InChIKey | LZRKYBIBJCIAPQ-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-[3-(3,5-dipyridin-4-ylphenyl)-5-fluorophenyl]-5-pyridin-4-ylphenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[3-(3,5-dipyridin-4-ylphenyl)-5-fluorophenyl]-5-pyridin-4-ylphenyl]pyridine?
The IUPAC name of 4-[3-[3-(3,5-dipyridin-4-ylphenyl)-5-fluorophenyl]-5-pyridin-4-ylphenyl]pyridine (CID 122209952) is 4-[3-[3-(3,5-dipyridin-4-ylphenyl)-5-fluorophenyl]-5-pyridin-4-ylphenyl]pyridine.
What is the SMILES notation for 4-[3-[3-(3,5-dipyridin-4-ylphenyl)-5-fluorophenyl]-5-pyridin-4-ylphenyl]pyridine?
The canonical SMILES for 4-[3-[3-(3,5-dipyridin-4-ylphenyl)-5-fluorophenyl]-5-pyridin-4-ylphenyl]pyridine is Fc1cc(-c2cc(-c3ccncc3)cc(-c3ccncc3)c2)cc(-c2cc(-c3ccncc3)cc(-c3ccncc3)c2)c1.
What is the InChIKey of 4-[3-[3-(3,5-dipyridin-4-ylphenyl)-5-fluorophenyl]-5-pyridin-4-ylphenyl]pyridine?
The InChIKey is LZRKYBIBJCIAPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H25FN4/c39-38-24-36(34-19-30(26-1-9-40-10-2-26)17-31(20-34)27-3-11-41-12-4-27)23-37(25-38)35-21-32(28-5-13-42-14-6-28)18-33(22-35)29-7-15-43-16-8-29/h1-25H.
What are the key properties of 4-[3-[3-(3,5-dipyridin-4-ylphenyl)-5-fluorophenyl]-5-pyridin-4-ylphenyl]pyridine?
4-[3-[3-(3,5-dipyridin-4-ylphenyl)-5-fluorophenyl]-5-pyridin-4-ylphenyl]pyridine has a molecular weight of 556.64 g/mol, XLogP of 9.41, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[3-(3,5-dipyridin-4-ylphenyl)-5-fluorophenyl]-5-pyridin-4-ylphenyl]pyridine is sourced from PubChem (CID 122209952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).