About CID 122210238
CID 122210238 (PubChem CID 122210238) has the molecular formula C6H11N2O
and a molecular weight of 127.17 g/mol.
Molecular Properties
| Compound Name | CID 122210238 |
| PubChem CID | 122210238 |
| Molecular Formula | C6H11N2O |
| Molecular Weight | 127.17 g/mol |
| Exact Mass | 127.09 |
| IUPAC Name | — |
| SMILES | CN1[CH]N(CCO)C=C1 |
| InChI | InChI=1S/C6H11N2O/c1-7-2-3-8(6-7)4-5-9/h2-3,6,9H,4-5H2,1H3 |
| InChIKey | XXLXTWBXQKNVCJ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.17 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 122210238 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 122210238?
The IUPAC name of CID 122210238 (CID 122210238) is not available.
What is the SMILES notation for CID 122210238?
The canonical SMILES for CID 122210238 is CN1[CH]N(CCO)C=C1.
What is the InChIKey of CID 122210238?
The InChIKey is XXLXTWBXQKNVCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N2O/c1-7-2-3-8(6-7)4-5-9/h2-3,6,9H,4-5H2,1H3.
What are the key properties of CID 122210238?
CID 122210238 has a molecular weight of 127.17 g/mol, XLogP of -0.18, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 122210238 is sourced from PubChem (CID 122210238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).