C29H36Si2 — CID 122210293
trimethyl-[(1S,4R)-2,3,5-triphenyl-4-trimethylsilylcyclopent-2-en-1-yl]silane (PubChem CID 122210293) has the molecular formula C29H36Si2 and a molecular weight of 440.78 g/mol. Its IUPAC name is trimethyl-[(1S,4R)-2,3,5-triphenyl-4-trimethylsilylcyclopent-2-en-1-yl]silane.
| Compound Name | trimethyl-[(1S,4R)-2,3,5-triphenyl-4-trimethylsilylcyclopent-2-en-1-yl]silane |
|---|---|
| PubChem CID | 122210293 |
| Molecular Formula | C29H36Si2 |
| Molecular Weight | 440.78 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | trimethyl-[(1S,4R)-2,3,5-triphenyl-4-trimethylsilylcyclopent-2-en-1-yl]silane |
| SMILES | C[Si](C)(C)[C@@H]1C(c2ccccc2)=C(c2ccccc2)[C@H]([Si](C)(C)C)C1c1ccccc1 |
| InChI | InChI=1S/C29H36Si2/c1-30(2,3)28-25(22-16-10-7-11-17-22)26(23-18-12-8-13-19-23)29(31(4,5)6)27(28)24-20-14-9-15-21-24/h7-21,27-29H,1-6H3/t27?,28-,29+ |
| InChIKey | WISOELPXFCMPKY-UETHYEEUSA-N |
| XLogP | 8.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.78 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|