C16H21NO2Si — CID 122210561
(1R,2S,4R,5S)-5-[[dimethyl(phenyl)silyl]methyl]-3-oxa-6-azatricyclo[4.3.0.02,4]nonan-7-one (PubChem CID 122210561) has the molecular formula C16H21NO2Si and a molecular weight of 287.43 g/mol. Its IUPAC name is (1R,2S,4R,5S)-5-[[dimethyl(phenyl)silyl]methyl]-3-oxa-6-azatricyclo[4.3.0.02,4]nonan-7-one.
| Compound Name | (1R,2S,4R,5S)-5-[[dimethyl(phenyl)silyl]methyl]-3-oxa-6-azatricyclo[4.3.0.02,4]nonan-7-one |
|---|---|
| PubChem CID | 122210561 |
| Molecular Formula | C16H21NO2Si |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (1R,2S,4R,5S)-5-[[dimethyl(phenyl)silyl]methyl]-3-oxa-6-azatricyclo[4.3.0.02,4]nonan-7-one |
| SMILES | C[Si](C)(C[C@@H]1[C@H]2O[C@H]2[C@H]2CCC(=O)N21)c1ccccc1 |
| InChI | InChI=1S/C16H21NO2Si/c1-20(2,11-6-4-3-5-7-11)10-13-16-15(19-16)12-8-9-14(18)17(12)13/h3-7,12-13,15-16H,8-10H2,1-2H3/t12-,13-,15+,16-/m1/s1 |
| InChIKey | KKLDFJATHYXSOD-LUYZLQTOSA-N |
| XLogP | 1.74 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|