C16H23NO3Si — CID 122210562
(5S,6R,7R,8R)-5-[[dimethyl(phenyl)silyl]methyl]-6,7-dihydroxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 122210562) has the molecular formula C16H23NO3Si and a molecular weight of 305.45 g/mol. Its IUPAC name is (5S,6R,7R,8R)-5-[[dimethyl(phenyl)silyl]methyl]-6,7-dihydroxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (5S,6R,7R,8R)-5-[[dimethyl(phenyl)silyl]methyl]-6,7-dihydroxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 122210562 |
| Molecular Formula | C16H23NO3Si |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (5S,6R,7R,8R)-5-[[dimethyl(phenyl)silyl]methyl]-6,7-dihydroxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | C[Si](C)(C[C@@H]1[C@@H](O)[C@H](O)[C@H]2CCC(=O)N21)c1ccccc1 |
| InChI | InChI=1S/C16H23NO3Si/c1-21(2,11-6-4-3-5-7-11)10-13-16(20)15(19)12-8-9-14(18)17(12)13/h3-7,12-13,15-16,19-20H,8-10H2,1-2H3/t12-,13-,15-,16-/m1/s1 |
| InChIKey | KSYVZIQAFJSXQQ-RRCSTGOVSA-N |
| XLogP | 0.70 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|