C26H39F3O6SSi — CID 122210675
[(2S,3R,4R,5S,6R)-6-ethylsulfanyl-2-methyl-4-(2,2,2-trifluoroacetyl)oxy-5-tri(propan-2-yl)silyloxyoxan-3-yl] benzoate (PubChem CID 122210675) has the molecular formula C26H39F3O6SSi and a molecular weight of 564.74 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-6-ethylsulfanyl-2-methyl-4-(2,2,2-trifluoroacetyl)oxy-5-tri(propan-2-yl)silyloxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4R,5S,6R)-6-ethylsulfanyl-2-methyl-4-(2,2,2-trifluoroacetyl)oxy-5-tri(propan-2-yl)silyloxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 122210675 |
| Molecular Formula | C26H39F3O6SSi |
| Molecular Weight | 564.74 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-6-ethylsulfanyl-2-methyl-4-(2,2,2-trifluoroacetyl)oxy-5-tri(propan-2-yl)silyloxyoxan-3-yl] benzoate |
| SMILES | CCS[C@H]1O[C@@H](C)[C@@H](OC(=O)c2ccccc2)[C@@H](OC(=O)C(F)(F)F)[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H39F3O6SSi/c1-9-36-24-22(35-37(15(2)3,16(4)5)17(6)7)21(34-25(31)26(27,28)29)20(18(8)32-24)33-23(30)19-13-11-10-12-14-19/h10-18,20-22,24H,9H2,1-8H3/t18-,20+,21+,22-,24+/m0/s1 |
| InChIKey | OJNRZJBRBZKQMG-MMIGAADJSA-N |
| XLogP | 6.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.74 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|