About [5-(hydroxymethyl)-3,6-dimethylpyrazin-2-yl]methyl 2,2-dimethylpropanoate
[5-(hydroxymethyl)-3,6-dimethylpyrazin-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 122210737) has the molecular formula C13H20N2O3
and a molecular weight of 252.31 g/mol. Its IUPAC name is [5-(hydroxymethyl)-3,6-dimethylpyrazin-2-yl]methyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [5-(hydroxymethyl)-3,6-dimethylpyrazin-2-yl]methyl 2,2-dimethylpropanoate |
| PubChem CID | 122210737 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | [5-(hydroxymethyl)-3,6-dimethylpyrazin-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | Cc1nc(COC(=O)C(C)(C)C)c(C)nc1CO |
| InChI | InChI=1S/C13H20N2O3/c1-8-10(6-16)14-9(2)11(15-8)7-18-12(17)13(3,4)5/h16H,6-7H2,1-5H3 |
| InChIKey | PKQUJVVFNMXUAW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(hydroxymethyl)-3,6-dimethylpyrazin-2-yl]methyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(hydroxymethyl)-3,6-dimethylpyrazin-2-yl]methyl 2,2-dimethylpropanoate?
The IUPAC name of [5-(hydroxymethyl)-3,6-dimethylpyrazin-2-yl]methyl 2,2-dimethylpropanoate (CID 122210737) is [5-(hydroxymethyl)-3,6-dimethylpyrazin-2-yl]methyl 2,2-dimethylpropanoate.
What is the SMILES notation for [5-(hydroxymethyl)-3,6-dimethylpyrazin-2-yl]methyl 2,2-dimethylpropanoate?
The canonical SMILES for [5-(hydroxymethyl)-3,6-dimethylpyrazin-2-yl]methyl 2,2-dimethylpropanoate is Cc1nc(COC(=O)C(C)(C)C)c(C)nc1CO.
What is the InChIKey of [5-(hydroxymethyl)-3,6-dimethylpyrazin-2-yl]methyl 2,2-dimethylpropanoate?
The InChIKey is PKQUJVVFNMXUAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O3/c1-8-10(6-16)14-9(2)11(15-8)7-18-12(17)13(3,4)5/h16H,6-7H2,1-5H3.
What are the key properties of [5-(hydroxymethyl)-3,6-dimethylpyrazin-2-yl]methyl 2,2-dimethylpropanoate?
[5-(hydroxymethyl)-3,6-dimethylpyrazin-2-yl]methyl 2,2-dimethylpropanoate has a molecular weight of 252.31 g/mol, XLogP of 1.68, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(hydroxymethyl)-3,6-dimethylpyrazin-2-yl]methyl 2,2-dimethylpropanoate is sourced from PubChem (CID 122210737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).