C26H22N2O3 — CID 122210764
2-[2-[(2S,3R)-2-(4-methylphenyl)-4-oxo-1-phenylazetidin-3-yl]ethyl]isoindole-1,3-dione (PubChem CID 122210764) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-[2-[(2S,3R)-2-(4-methylphenyl)-4-oxo-1-phenylazetidin-3-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(2S,3R)-2-(4-methylphenyl)-4-oxo-1-phenylazetidin-3-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122210764 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-[2-[(2S,3R)-2-(4-methylphenyl)-4-oxo-1-phenylazetidin-3-yl]ethyl]isoindole-1,3-dione |
| SMILES | Cc1ccc([C@@H]2[C@@H](CCN3C(=O)c4ccccc4C3=O)C(=O)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H22N2O3/c1-17-11-13-18(14-12-17)23-22(26(31)28(23)19-7-3-2-4-8-19)15-16-27-24(29)20-9-5-6-10-21(20)25(27)30/h2-14,22-23H,15-16H2,1H3/t22-,23-/m1/s1 |
| InChIKey | SHMBHEFBJMAQNP-DHIUTWEWSA-N |
| XLogP | 4.39 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|