C19H24N2O2 — CID 122211416
(1S,3R,11S,15S)-1-ethyl-2-oxa-4,14-diazahexacyclo[12.5.1.03,18.04,15.05,10.011,15]icosa-5,7,9-trien-11-ol (PubChem CID 122211416) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is (1S,3R,11S,15S)-1-ethyl-2-oxa-4,14-diazahexacyclo[12.5.1.03,18.04,15.05,10.011,15]icosa-5,7,9-trien-11-ol.
| Compound Name | (1S,3R,11S,15S)-1-ethyl-2-oxa-4,14-diazahexacyclo[12.5.1.03,18.04,15.05,10.011,15]icosa-5,7,9-trien-11-ol |
|---|---|
| PubChem CID | 122211416 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (1S,3R,11S,15S)-1-ethyl-2-oxa-4,14-diazahexacyclo[12.5.1.03,18.04,15.05,10.011,15]icosa-5,7,9-trien-11-ol |
| SMILES | CC[C@@]12CC3CC[C@@]45N(CC[C@]4(O)c4ccccc4N5[C@@H]3O1)C2 |
| InChI | InChI=1S/C19H24N2O2/c1-2-17-11-13-7-8-19-18(22,9-10-20(19)12-17)14-5-3-4-6-15(14)21(19)16(13)23-17/h3-6,13,16,22H,2,7-12H2,1H3/t13?,16-,17+,18+,19+/m1/s1 |
| InChIKey | ABVZAIXFWDNWHU-MWWGDSTRSA-N |
| XLogP | 2.41 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |