C12H13NO3 — CID 122211507
(1S,2S,7R,9R)-5-methyl-8-oxo-10,12-dioxatricyclo[7.2.1.02,7]dodec-4-ene-2-carbonitrile (PubChem CID 122211507) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is (1S,2S,7R,9R)-5-methyl-8-oxo-10,12-dioxatricyclo[7.2.1.02,7]dodec-4-ene-2-carbonitrile.
| Compound Name | (1S,2S,7R,9R)-5-methyl-8-oxo-10,12-dioxatricyclo[7.2.1.02,7]dodec-4-ene-2-carbonitrile |
|---|---|
| PubChem CID | 122211507 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (1S,2S,7R,9R)-5-methyl-8-oxo-10,12-dioxatricyclo[7.2.1.02,7]dodec-4-ene-2-carbonitrile |
| SMILES | CC1=CC[C@]2(C#N)[C@H]3CO[C@H](O3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C12H13NO3/c1-7-2-3-12(6-13)8(4-7)10(14)11-15-5-9(12)16-11/h2,8-9,11H,3-5H2,1H3/t8-,9+,11+,12+/m0/s1 |
| InChIKey | WMNBAEJJHAOTNZ-LUTQBAROSA-N |
| XLogP | 1.18 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|