About 2-[(1R,2R)-2-(furan-3-yl)cyclopropyl]ethanol
2-[(1R,2R)-2-(furan-3-yl)cyclopropyl]ethanol (PubChem CID 122211518) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 2-[(1R,2R)-2-(furan-3-yl)cyclopropyl]ethanol.
Molecular Properties
| Compound Name | 2-[(1R,2R)-2-(furan-3-yl)cyclopropyl]ethanol |
| PubChem CID | 122211518 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 2-[(1R,2R)-2-(furan-3-yl)cyclopropyl]ethanol |
| SMILES | OCC[C@H]1C[C@H]1c1ccoc1 |
| InChI | InChI=1S/C9H12O2/c10-3-1-7-5-9(7)8-2-4-11-6-8/h2,4,6-7,9-10H,1,3,5H2/t7-,9+/m0/s1 |
| InChIKey | WBBFNBRIXVAEMC-IONNQARKSA-N |
| XLogP | 1.77 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(1R,2R)-2-(furan-3-yl)cyclopropyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,2R)-2-(furan-3-yl)cyclopropyl]ethanol?
The IUPAC name of 2-[(1R,2R)-2-(furan-3-yl)cyclopropyl]ethanol (CID 122211518) is 2-[(1R,2R)-2-(furan-3-yl)cyclopropyl]ethanol.
What is the SMILES notation for 2-[(1R,2R)-2-(furan-3-yl)cyclopropyl]ethanol?
The canonical SMILES for 2-[(1R,2R)-2-(furan-3-yl)cyclopropyl]ethanol is OCC[C@H]1C[C@H]1c1ccoc1.
What is the InChIKey of 2-[(1R,2R)-2-(furan-3-yl)cyclopropyl]ethanol?
The InChIKey is WBBFNBRIXVAEMC-IONNQARKSA-N. The full InChI is InChI=1S/C9H12O2/c10-3-1-7-5-9(7)8-2-4-11-6-8/h2,4,6-7,9-10H,1,3,5H2/t7-,9+/m0/s1.
What are the key properties of 2-[(1R,2R)-2-(furan-3-yl)cyclopropyl]ethanol?
2-[(1R,2R)-2-(furan-3-yl)cyclopropyl]ethanol has a molecular weight of 152.19 g/mol, XLogP of 1.77, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,2R)-2-(furan-3-yl)cyclopropyl]ethanol is sourced from PubChem (CID 122211518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).