C21H24KN5O3S — CID 122211526
potassium 3-[(2Z)-2-(phenyliminohydrazinylidene)-3-(2,4,6-trimethylphenyl)imidazol-1-yl]propane-1-sulfonate (PubChem CID 122211526) has the molecular formula C21H24KN5O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is potassium 3-[(2Z)-2-(phenyliminohydrazinylidene)-3-(2,4,6-trimethylphenyl)imidazol-1-yl]propane-1-sulfonate.
| Compound Name | potassium 3-[(2Z)-2-(phenyliminohydrazinylidene)-3-(2,4,6-trimethylphenyl)imidazol-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 122211526 |
| Molecular Formula | C21H24KN5O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | potassium 3-[(2Z)-2-(phenyliminohydrazinylidene)-3-(2,4,6-trimethylphenyl)imidazol-1-yl]propane-1-sulfonate |
| SMILES | Cc1cc(C)c(-n2ccn(CCCS(=O)(=O)[O-])/c2=N/N=N\c2ccccc2)c(C)c1.[K+] |
| InChI | InChI=1S/C21H25N5O3S.K/c1-16-14-17(2)20(18(3)15-16)26-12-11-25(10-7-13-30(27,28)29)21(26)23-24-22-19-8-5-4-6-9-19;/h4-6,8-9,11-12,14-15H,7,10,13H2,1-3H3,(H,27,28,29);/q;+1/p-1/b23-21-,24-22-; |
| InChIKey | PRKKYCCVKCVKFA-ZVDJXTMWSA-M |
| XLogP | 0.74 |
| TPSA | 104.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|