C52H10F30N2 — CID 122212464
2-N,3-N-bis[2,4,6-tris(2,3,4,5,6-pentafluorophenyl)phenyl]butane-2,3-diimine (PubChem CID 122212464) has the molecular formula C52H10F30N2 and a molecular weight of 1232.61 g/mol. Its IUPAC name is 2-N,3-N-bis[2,4,6-tris(2,3,4,5,6-pentafluorophenyl)phenyl]butane-2,3-diimine.
| Compound Name | 2-N,3-N-bis[2,4,6-tris(2,3,4,5,6-pentafluorophenyl)phenyl]butane-2,3-diimine |
|---|---|
| PubChem CID | 122212464 |
| Molecular Formula | C52H10F30N2 |
| Molecular Weight | 1232.61 g/mol |
| Exact Mass | 1232.04 |
| IUPAC Name | 2-N,3-N-bis[2,4,6-tris(2,3,4,5,6-pentafluorophenyl)phenyl]butane-2,3-diimine |
| SMILES | CC(=N\c1c(-c2c(F)c(F)c(F)c(F)c2F)cc(-c2c(F)c(F)c(F)c(F)c2F)cc1-c1c(F)c(F)c(F)c(F)c1F)/C(C)=N/c1c(-c2c(F)c(F)c(F)c(F)c2F)cc(-c2c(F)c(F)c(F)c(F)c2F)cc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C52H10F30N2/c1-7(83-51-11(17-25(57)37(69)47(79)38(70)26(17)58)3-9(15-21(53)33(65)45(77)34(66)22(15)54)4-12(51)18-27(59)39(71)48(80)40(72)28(18)60)8(2)84-52-13(19-29(61)41(73)49(81)42(74)30(19)62)5-10(16-23(55)35(67)46(78)36(68)24(16)56)6-14(52)20-31(63)43(75)50(82)44(76)32(20)64/h3-6H,1-2H3/b83-7+,84-8+ |
| InChIKey | IPOQMYGMPKFLQW-SNJCFXPFSA-N |
| XLogP | 18.75 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1232.61 |
| LogP ≤ 5 | 18.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|