C19H16BrFN2O — CID 122212491
2-[5-bromo-3-fluoro-2-(1-methylindol-3-yl)indol-1-yl]ethanol (PubChem CID 122212491) has the molecular formula C19H16BrFN2O and a molecular weight of 387.25 g/mol. Its IUPAC name is 2-[5-bromo-3-fluoro-2-(1-methylindol-3-yl)indol-1-yl]ethanol.
| Compound Name | 2-[5-bromo-3-fluoro-2-(1-methylindol-3-yl)indol-1-yl]ethanol |
|---|---|
| PubChem CID | 122212491 |
| Molecular Formula | C19H16BrFN2O |
| Molecular Weight | 387.25 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 2-[5-bromo-3-fluoro-2-(1-methylindol-3-yl)indol-1-yl]ethanol |
| SMILES | Cn1cc(-c2c(F)c3cc(Br)ccc3n2CCO)c2ccccc21 |
| InChI | InChI=1S/C19H16BrFN2O/c1-22-11-15(13-4-2-3-5-16(13)22)19-18(21)14-10-12(20)6-7-17(14)23(19)8-9-24/h2-7,10-11,24H,8-9H2,1H3 |
| InChIKey | MACUOAWMZALOKM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 30.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.25 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |