About [2-[(2-diazoacetyl)oxymethyl]cyclohexyl]methyl 2-diazoacetate
[2-[(2-diazoacetyl)oxymethyl]cyclohexyl]methyl 2-diazoacetate (PubChem CID 122212636) has the molecular formula C12H16N4O4
and a molecular weight of 280.28 g/mol. Its IUPAC name is [2-[(2-diazoacetyl)oxymethyl]cyclohexyl]methyl 2-diazoacetate.
Molecular Properties
| Compound Name | [2-[(2-diazoacetyl)oxymethyl]cyclohexyl]methyl 2-diazoacetate |
| PubChem CID | 122212636 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | [2-[(2-diazoacetyl)oxymethyl]cyclohexyl]methyl 2-diazoacetate |
| SMILES | [N-]=[N+]=CC(=O)OCC1CCCCC1COC(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C12H16N4O4/c13-15-5-11(17)19-7-9-3-1-2-4-10(9)8-20-12(18)6-16-14/h5-6,9-10H,1-4,7-8H2 |
| InChIKey | CVDCXLIWCNARJK-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 125.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2-diazoacetyl)oxymethyl]cyclohexyl]methyl 2-diazoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2-diazoacetyl)oxymethyl]cyclohexyl]methyl 2-diazoacetate?
The IUPAC name of [2-[(2-diazoacetyl)oxymethyl]cyclohexyl]methyl 2-diazoacetate (CID 122212636) is [2-[(2-diazoacetyl)oxymethyl]cyclohexyl]methyl 2-diazoacetate.
What is the SMILES notation for [2-[(2-diazoacetyl)oxymethyl]cyclohexyl]methyl 2-diazoacetate?
The canonical SMILES for [2-[(2-diazoacetyl)oxymethyl]cyclohexyl]methyl 2-diazoacetate is [N-]=[N+]=CC(=O)OCC1CCCCC1COC(=O)C=[N+]=[N-].
What is the InChIKey of [2-[(2-diazoacetyl)oxymethyl]cyclohexyl]methyl 2-diazoacetate?
The InChIKey is CVDCXLIWCNARJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O4/c13-15-5-11(17)19-7-9-3-1-2-4-10(9)8-20-12(18)6-16-14/h5-6,9-10H,1-4,7-8H2.
What are the key properties of [2-[(2-diazoacetyl)oxymethyl]cyclohexyl]methyl 2-diazoacetate?
[2-[(2-diazoacetyl)oxymethyl]cyclohexyl]methyl 2-diazoacetate has a molecular weight of 280.28 g/mol, XLogP of 0.48, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2-diazoacetyl)oxymethyl]cyclohexyl]methyl 2-diazoacetate is sourced from PubChem (CID 122212636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).