C13H20NO4P — CID 122213568
6-diethoxyphosphoryl-4,7-dimethyl-1,3-dihydrofuro[3,4-c]pyridine (PubChem CID 122213568) has the molecular formula C13H20NO4P and a molecular weight of 285.28 g/mol. Its IUPAC name is 6-diethoxyphosphoryl-4,7-dimethyl-1,3-dihydrofuro[3,4-c]pyridine.
| Compound Name | 6-diethoxyphosphoryl-4,7-dimethyl-1,3-dihydrofuro[3,4-c]pyridine |
|---|---|
| PubChem CID | 122213568 |
| Molecular Formula | C13H20NO4P |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 6-diethoxyphosphoryl-4,7-dimethyl-1,3-dihydrofuro[3,4-c]pyridine |
| SMILES | CCOP(=O)(OCC)c1nc(C)c2c(c1C)COC2 |
| InChI | InChI=1S/C13H20NO4P/c1-5-17-19(15,18-6-2)13-9(3)11-7-16-8-12(11)10(4)14-13/h5-8H2,1-4H3 |
| InChIKey | OQVNHXSODODGSD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|