C50H46Br2O8 — CID 122213996
dipropyl (Z)-2-(2-bromophenyl)-3-[12-[(Z)-3-(2-bromophenyl)-1,4-dioxo-1,4-dipropoxybut-2-en-2-yl]chrysen-6-yl]but-2-enedioate (PubChem CID 122213996) has the molecular formula C50H46Br2O8 and a molecular weight of 934.72 g/mol. Its IUPAC name is dipropyl (Z)-2-(2-bromophenyl)-3-[12-[(Z)-3-(2-bromophenyl)-1,4-dioxo-1,4-dipropoxybut-2-en-2-yl]chrysen-6-yl]but-2-enedioate.
| Compound Name | dipropyl (Z)-2-(2-bromophenyl)-3-[12-[(Z)-3-(2-bromophenyl)-1,4-dioxo-1,4-dipropoxybut-2-en-2-yl]chrysen-6-yl]but-2-enedioate |
|---|---|
| PubChem CID | 122213996 |
| Molecular Formula | C50H46Br2O8 |
| Molecular Weight | 934.72 g/mol |
| Exact Mass | 932.16 |
| IUPAC Name | dipropyl (Z)-2-(2-bromophenyl)-3-[12-[(Z)-3-(2-bromophenyl)-1,4-dioxo-1,4-dipropoxybut-2-en-2-yl]chrysen-6-yl]but-2-enedioate |
| SMILES | CCCOC(=O)/C(=C(\C(=O)OCCC)c1cc2c3ccccc3c(/C(C(=O)OCCC)=C(/C(=O)OCCC)c3ccccc3Br)cc2c2ccccc12)c1ccccc1Br |
| InChI | InChI=1S/C50H46Br2O8/c1-5-25-57-47(53)43(35-21-13-15-23-41(35)51)45(49(55)59-27-7-3)39-29-37-32-18-10-12-20-34(32)40(30-38(37)31-17-9-11-19-33(31)39)46(50(56)60-28-8-4)44(48(54)58-26-6-2)36-22-14-16-24-42(36)52/h9-24,29-30H,5-8,25-28H2,1-4H3/b45-43-,46-44- |
| InChIKey | GYPSYBIXCBVXNW-ZRNPZBRYSA-N |
| XLogP | 12.31 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.72 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|