C22H16N2 — CID 122214138
N-methyl-4-[8-[4-(methylamino)phenyl]octa-1,3,5,7-tetraynyl]aniline (PubChem CID 122214138) has the molecular formula C22H16N2 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-methyl-4-[8-[4-(methylamino)phenyl]octa-1,3,5,7-tetraynyl]aniline.
| Compound Name | N-methyl-4-[8-[4-(methylamino)phenyl]octa-1,3,5,7-tetraynyl]aniline |
|---|---|
| PubChem CID | 122214138 |
| Molecular Formula | C22H16N2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-methyl-4-[8-[4-(methylamino)phenyl]octa-1,3,5,7-tetraynyl]aniline |
| SMILES | CNc1ccc(C#CC#CC#CC#Cc2ccc(NC)cc2)cc1 |
| InChI | InChI=1S/C22H16N2/c1-23-21-15-11-19(12-16-21)9-7-5-3-4-6-8-10-20-13-17-22(24-2)18-14-20/h11-18,23-24H,1-2H3 |
| InChIKey | WFFHSFWOGUMQGD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|