C24H20N2 — CID 122214140
4-[8-(4-amino-2,6-dimethylphenyl)octa-1,3,5,7-tetraynyl]-3,5-dimethylaniline (PubChem CID 122214140) has the molecular formula C24H20N2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-[8-(4-amino-2,6-dimethylphenyl)octa-1,3,5,7-tetraynyl]-3,5-dimethylaniline.
| Compound Name | 4-[8-(4-amino-2,6-dimethylphenyl)octa-1,3,5,7-tetraynyl]-3,5-dimethylaniline |
|---|---|
| PubChem CID | 122214140 |
| Molecular Formula | C24H20N2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4-[8-(4-amino-2,6-dimethylphenyl)octa-1,3,5,7-tetraynyl]-3,5-dimethylaniline |
| SMILES | Cc1cc(N)cc(C)c1C#CC#CC#CC#Cc1c(C)cc(N)cc1C |
| InChI | InChI=1S/C24H20N2/c1-17-13-21(25)14-18(2)23(17)11-9-7-5-6-8-10-12-24-19(3)15-22(26)16-20(24)4/h13-16H,25-26H2,1-4H3 |
| InChIKey | QDZNWQVOLCYIPT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|