C22H16Cl3NO4 — CID 122214417
2-[2-[(3S,4S)-2-oxo-4-phenyl-6-(trichloromethyl)-3,4-dihydropyran-3-yl]ethyl]isoindole-1,3-dione (PubChem CID 122214417) has the molecular formula C22H16Cl3NO4 and a molecular weight of 464.73 g/mol. Its IUPAC name is 2-[2-[(3S,4S)-2-oxo-4-phenyl-6-(trichloromethyl)-3,4-dihydropyran-3-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(3S,4S)-2-oxo-4-phenyl-6-(trichloromethyl)-3,4-dihydropyran-3-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122214417 |
| Molecular Formula | C22H16Cl3NO4 |
| Molecular Weight | 464.73 g/mol |
| Exact Mass | 463.01 |
| IUPAC Name | 2-[2-[(3S,4S)-2-oxo-4-phenyl-6-(trichloromethyl)-3,4-dihydropyran-3-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1OC(C(Cl)(Cl)Cl)=C[C@H](c2ccccc2)[C@@H]1CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H16Cl3NO4/c23-22(24,25)18-12-17(13-6-2-1-3-7-13)16(21(29)30-18)10-11-26-19(27)14-8-4-5-9-15(14)20(26)28/h1-9,12,16-17H,10-11H2/t16-,17+/m0/s1 |
| InChIKey | HBHUHRJAIFMTIZ-DLBZAZTESA-N |
| XLogP | 4.88 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.73 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|