C13H8F5N3O2 — CID 122214515
(3aR,6aR)-3-(1,1,2,2,2-pentafluoroethyl)-5-phenyl-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-4,6-dione (PubChem CID 122214515) has the molecular formula C13H8F5N3O2 and a molecular weight of 333.22 g/mol. Its IUPAC name is (3aR,6aR)-3-(1,1,2,2,2-pentafluoroethyl)-5-phenyl-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-4,6-dione.
| Compound Name | (3aR,6aR)-3-(1,1,2,2,2-pentafluoroethyl)-5-phenyl-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-4,6-dione |
|---|---|
| PubChem CID | 122214515 |
| Molecular Formula | C13H8F5N3O2 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | (3aR,6aR)-3-(1,1,2,2,2-pentafluoroethyl)-5-phenyl-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-4,6-dione |
| SMILES | O=C1[C@H]2C(C(F)(F)C(F)(F)F)=NN[C@H]2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C13H8F5N3O2/c14-12(15,13(16,17)18)9-7-8(19-20-9)11(23)21(10(7)22)6-4-2-1-3-5-6/h1-5,7-8,19H/t7-,8-/m1/s1 |
| InChIKey | ZNPAXAPHPPZAOI-HTQZYQBOSA-N |
| XLogP | 1.70 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|