C13H11F5N4O4 — CID 122214528
ethyl (3R,5R)-5-(3-nitro-2-pyridinyl)-3-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazole-5-carboxylate (PubChem CID 122214528) has the molecular formula C13H11F5N4O4 and a molecular weight of 382.25 g/mol. Its IUPAC name is ethyl (3R,5R)-5-(3-nitro-2-pyridinyl)-3-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazole-5-carboxylate.
| Compound Name | ethyl (3R,5R)-5-(3-nitro-2-pyridinyl)-3-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 122214528 |
| Molecular Formula | C13H11F5N4O4 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | ethyl (3R,5R)-5-(3-nitro-2-pyridinyl)-3-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazole-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(c2ncccc2[N+](=O)[O-])C[C@H](C(F)(F)C(F)(F)F)N=N1 |
| InChI | InChI=1S/C13H11F5N4O4/c1-2-26-10(23)11(9-7(22(24)25)4-3-5-19-9)6-8(20-21-11)12(14,15)13(16,17)18/h3-5,8H,2,6H2,1H3/t8-,11-/m1/s1 |
| InChIKey | DTAVGPZQGWHZBF-LDYMZIIASA-N |
| XLogP | 3.17 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|