C16H16N2S7 — CID 122214973
6-[4,5-bis(propylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-f][2,1,3]benzothiadiazole (PubChem CID 122214973) has the molecular formula C16H16N2S7 and a molecular weight of 460.79 g/mol. Its IUPAC name is 6-[4,5-bis(propylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-f][2,1,3]benzothiadiazole.
| Compound Name | 6-[4,5-bis(propylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-f][2,1,3]benzothiadiazole |
|---|---|
| PubChem CID | 122214973 |
| Molecular Formula | C16H16N2S7 |
| Molecular Weight | 460.79 g/mol |
| Exact Mass | 459.94 |
| IUPAC Name | 6-[4,5-bis(propylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-f][2,1,3]benzothiadiazole |
| SMILES | CCCSC1=C(SCCC)SC(=C2Sc3cc4nsnc4cc3S2)S1 |
| InChI | InChI=1S/C16H16N2S7/c1-3-5-19-13-14(20-6-4-2)24-16(23-13)15-21-11-7-9-10(18-25-17-9)8-12(11)22-15/h7-8H,3-6H2,1-2H3 |
| InChIKey | PAQHRCNANHBZRK-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.79 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |