C18H25NS — CID 122215583
2,2-dimethyl-1-(3-phenyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propane-1-thione (PubChem CID 122215583) has the molecular formula C18H25NS and a molecular weight of 287.47 g/mol. Its IUPAC name is 2,2-dimethyl-1-(3-phenyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propane-1-thione.
| Compound Name | 2,2-dimethyl-1-(3-phenyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propane-1-thione |
|---|---|
| PubChem CID | 122215583 |
| Molecular Formula | C18H25NS |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2,2-dimethyl-1-(3-phenyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propane-1-thione |
| SMILES | CC(C)(C)C(=S)N1CC2CCCC2C1c1ccccc1 |
| InChI | InChI=1S/C18H25NS/c1-18(2,3)17(20)19-12-14-10-7-11-15(14)16(19)13-8-5-4-6-9-13/h4-6,8-9,14-16H,7,10-12H2,1-3H3 |
| InChIKey | AGSQNGKHCYZASQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|