C14H14N2 — CID 122216109
2-(1,2,3,4-tetrahydrocarbazol-4a-yl)acetonitrile (PubChem CID 122216109) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydrocarbazol-4a-yl)acetonitrile.
| Compound Name | 2-(1,2,3,4-tetrahydrocarbazol-4a-yl)acetonitrile |
|---|---|
| PubChem CID | 122216109 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 2-(1,2,3,4-tetrahydrocarbazol-4a-yl)acetonitrile |
| SMILES | N#CCC12CCCCC1=Nc1ccccc12 |
| InChI | InChI=1S/C14H14N2/c15-10-9-14-8-4-3-7-13(14)16-12-6-2-1-5-11(12)14/h1-2,5-6H,3-4,7-9H2 |
| InChIKey | ZEBSEALPPZXMTG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |