C27H32F2N2O6 — CID 122216478
tert-butyl N-[1-(2,2-diethoxyethyl)-3-(1,1-difluoro-2-oxo-2-phenylethyl)-2-oxoindol-3-yl]carbamate (PubChem CID 122216478) has the molecular formula C27H32F2N2O6 and a molecular weight of 518.56 g/mol. Its IUPAC name is tert-butyl N-[1-(2,2-diethoxyethyl)-3-(1,1-difluoro-2-oxo-2-phenylethyl)-2-oxoindol-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2,2-diethoxyethyl)-3-(1,1-difluoro-2-oxo-2-phenylethyl)-2-oxoindol-3-yl]carbamate |
|---|---|
| PubChem CID | 122216478 |
| Molecular Formula | C27H32F2N2O6 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | tert-butyl N-[1-(2,2-diethoxyethyl)-3-(1,1-difluoro-2-oxo-2-phenylethyl)-2-oxoindol-3-yl]carbamate |
| SMILES | CCOC(CN1C(=O)C(NC(=O)OC(C)(C)C)(C(F)(F)C(=O)c2ccccc2)c2ccccc21)OCC |
| InChI | InChI=1S/C27H32F2N2O6/c1-6-35-21(36-7-2)17-31-20-16-12-11-15-19(20)26(23(31)33,30-24(34)37-25(3,4)5)27(28,29)22(32)18-13-9-8-10-14-18/h8-16,21H,6-7,17H2,1-5H3,(H,30,34) |
| InChIKey | INAJYPIHRBQPQX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|