C26H29N3O6 — CID 122217108
(E)-4-azido-4-(2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)-5-phenylmethoxypent-2-enal (PubChem CID 122217108) has the molecular formula C26H29N3O6 and a molecular weight of 479.53 g/mol. Its IUPAC name is (E)-4-azido-4-(2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)-5-phenylmethoxypent-2-enal.
| Compound Name | (E)-4-azido-4-(2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)-5-phenylmethoxypent-2-enal |
|---|---|
| PubChem CID | 122217108 |
| Molecular Formula | C26H29N3O6 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | (E)-4-azido-4-(2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)-5-phenylmethoxypent-2-enal |
| SMILES | CC1(C)OC2C(OCc3ccccc3)OC(C(/C=C/C=O)(COCc3ccccc3)N=[N+]=[N-])C2O1 |
| InChI | InChI=1S/C26H29N3O6/c1-25(2)34-21-22(35-25)24(32-17-20-12-7-4-8-13-20)33-23(21)26(28-29-27,14-9-15-30)18-31-16-19-10-5-3-6-11-19/h3-15,21-24H,16-18H2,1-2H3/b14-9+ |
| InChIKey | ADDWXXZZUZMNOM-NTEUORMPSA-N |
| XLogP | 4.47 |
| TPSA | 111.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|