C23H19Cl4N3 — CID 122217199
2-N,6-N-bis(4-chloro-2,6-dimethylphenyl)pyridine-2,6-dicarboximidoyl chloride (PubChem CID 122217199) has the molecular formula C23H19Cl4N3 and a molecular weight of 479.24 g/mol. Its IUPAC name is 2-N,6-N-bis(4-chloro-2,6-dimethylphenyl)pyridine-2,6-dicarboximidoyl chloride.
| Compound Name | 2-N,6-N-bis(4-chloro-2,6-dimethylphenyl)pyridine-2,6-dicarboximidoyl chloride |
|---|---|
| PubChem CID | 122217199 |
| Molecular Formula | C23H19Cl4N3 |
| Molecular Weight | 479.24 g/mol |
| Exact Mass | 477.03 |
| IUPAC Name | 2-N,6-N-bis(4-chloro-2,6-dimethylphenyl)pyridine-2,6-dicarboximidoyl chloride |
| SMILES | Cc1cc(Cl)cc(C)c1/N=C(\Cl)c1cccc(/C(Cl)=N/c2c(C)cc(Cl)cc2C)n1 |
| InChI | InChI=1S/C23H19Cl4N3/c1-12-8-16(24)9-13(2)20(12)29-22(26)18-6-5-7-19(28-18)23(27)30-21-14(3)10-17(25)11-15(21)4/h5-11H,1-4H3/b29-22-,30-23- |
| InChIKey | SJLRBCOTRCRBMD-TVUQKFFQSA-N |
| XLogP | 8.26 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.24 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|