C22H18N2O3 — CID 122217291
3-[5-(4-methoxyphenyl)-2-(3-methylimidazol-4-yl)-1-benzofuran-3-yl]prop-2-yn-1-ol (PubChem CID 122217291) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 3-[5-(4-methoxyphenyl)-2-(3-methylimidazol-4-yl)-1-benzofuran-3-yl]prop-2-yn-1-ol.
| Compound Name | 3-[5-(4-methoxyphenyl)-2-(3-methylimidazol-4-yl)-1-benzofuran-3-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 122217291 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 3-[5-(4-methoxyphenyl)-2-(3-methylimidazol-4-yl)-1-benzofuran-3-yl]prop-2-yn-1-ol |
| SMILES | COc1ccc(-c2ccc3oc(-c4cncn4C)c(C#CCO)c3c2)cc1 |
| InChI | InChI=1S/C22H18N2O3/c1-24-14-23-13-20(24)22-18(4-3-11-25)19-12-16(7-10-21(19)27-22)15-5-8-17(26-2)9-6-15/h5-10,12-14,25H,11H2,1-2H3 |
| InChIKey | HWHASGLCGLBJNU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|