C52H70O2 — CID 122217633
6-methoxy-5-[2-methoxy-3-[2,4,6-tri(propan-2-yl)phenyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-7-[2,4,6-tri(propan-2-yl)phenyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 122217633) has the molecular formula C52H70O2 and a molecular weight of 727.13 g/mol. Its IUPAC name is 6-methoxy-5-[2-methoxy-3-[2,4,6-tri(propan-2-yl)phenyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-7-[2,4,6-tri(propan-2-yl)phenyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-methoxy-5-[2-methoxy-3-[2,4,6-tri(propan-2-yl)phenyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-7-[2,4,6-tri(propan-2-yl)phenyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 122217633 |
| Molecular Formula | C52H70O2 |
| Molecular Weight | 727.13 g/mol |
| Exact Mass | 726.54 |
| IUPAC Name | 6-methoxy-5-[2-methoxy-3-[2,4,6-tri(propan-2-yl)phenyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-7-[2,4,6-tri(propan-2-yl)phenyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | COc1c(-c2c(C(C)C)cc(C(C)C)cc2C(C)C)cc2c(c1-c1c3c(cc(-c4c(C(C)C)cc(C(C)C)cc4C(C)C)c1OC)CCCC3)CCCC2 |
| InChI | InChI=1S/C52H70O2/c1-29(2)37-25-41(31(5)6)47(42(26-37)32(7)8)45-23-35-19-15-17-21-39(35)49(51(45)53-13)50-40-22-18-16-20-36(40)24-46(52(50)54-14)48-43(33(9)10)27-38(30(3)4)28-44(48)34(11)12/h23-34H,15-22H2,1-14H3 |
| InChIKey | OTGKGVKCADINPB-UHFFFAOYSA-N |
| XLogP | 15.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.13 |
| LogP ≤ 5 | 15.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |