C36H26Cl2N2O4 — CID 122218094
ethyl 2-[(2S,3S)-1'-benzyl-4-cyano-2-(3,5-dichlorophenyl)-2'-oxo-5-phenylspiro[furan-3,3'-indole]-2-yl]prop-2-enoate (PubChem CID 122218094) has the molecular formula C36H26Cl2N2O4 and a molecular weight of 621.52 g/mol. Its IUPAC name is ethyl 2-[(2S,3S)-1'-benzyl-4-cyano-2-(3,5-dichlorophenyl)-2'-oxo-5-phenylspiro[furan-3,3'-indole]-2-yl]prop-2-enoate.
| Compound Name | ethyl 2-[(2S,3S)-1'-benzyl-4-cyano-2-(3,5-dichlorophenyl)-2'-oxo-5-phenylspiro[furan-3,3'-indole]-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 122218094 |
| Molecular Formula | C36H26Cl2N2O4 |
| Molecular Weight | 621.52 g/mol |
| Exact Mass | 620.13 |
| IUPAC Name | ethyl 2-[(2S,3S)-1'-benzyl-4-cyano-2-(3,5-dichlorophenyl)-2'-oxo-5-phenylspiro[furan-3,3'-indole]-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)[C@@]1(c2cc(Cl)cc(Cl)c2)OC(c2ccccc2)=C(C#N)[C@]12C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C36H26Cl2N2O4/c1-3-43-33(41)23(2)36(26-18-27(37)20-28(38)19-26)35(30(21-39)32(44-36)25-14-8-5-9-15-25)29-16-10-11-17-31(29)40(34(35)42)22-24-12-6-4-7-13-24/h4-20H,2-3,22H2,1H3/t35-,36+/m1/s1 |
| InChIKey | DBGULMUODLWWBY-XDSPJLLDSA-N |
| XLogP | 7.76 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.52 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|