C10H17NO7 — CID 122218237
(5S,6R,7S,8S,9R)-6,7,8-trihydroxy-9-(hydroxymethyl)-2,2-dimethyl-1,10-dioxa-3-azaspiro[4.5]decan-4-one (PubChem CID 122218237) has the molecular formula C10H17NO7 and a molecular weight of 263.25 g/mol. Its IUPAC name is (5S,6R,7S,8S,9R)-6,7,8-trihydroxy-9-(hydroxymethyl)-2,2-dimethyl-1,10-dioxa-3-azaspiro[4.5]decan-4-one.
| Compound Name | (5S,6R,7S,8S,9R)-6,7,8-trihydroxy-9-(hydroxymethyl)-2,2-dimethyl-1,10-dioxa-3-azaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 122218237 |
| Molecular Formula | C10H17NO7 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | (5S,6R,7S,8S,9R)-6,7,8-trihydroxy-9-(hydroxymethyl)-2,2-dimethyl-1,10-dioxa-3-azaspiro[4.5]decan-4-one |
| SMILES | CC1(C)NC(=O)[C@@]2(O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O1 |
| InChI | InChI=1S/C10H17NO7/c1-9(2)11-8(16)10(18-9)7(15)6(14)5(13)4(3-12)17-10/h4-7,12-15H,3H2,1-2H3,(H,11,16)/t4-,5-,6+,7-,10+/m1/s1 |
| InChIKey | ULICSAKJZAFRAB-UTAYWCBXSA-N |
| XLogP | -2.96 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |